C21H31N5O4S2 — CID 55998031
1-butyl-2-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-N,N-diethylbenzimidazole-5-sulfonamide (PubChem CID 55998031) has the molecular formula C21H31N5O4S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 1-butyl-2-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-N,N-diethylbenzimidazole-5-sulfonamide.
| Compound Name | 1-butyl-2-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-N,N-diethylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 55998031 |
| Molecular Formula | C21H31N5O4S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1-butyl-2-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-N,N-diethylbenzimidazole-5-sulfonamide |
| SMILES | CCCCn1c(SCCCN2C(=O)CNC2=O)nc2cc(S(=O)(=O)N(CC)CC)ccc21 |
| InChI | InChI=1S/C21H31N5O4S2/c1-4-7-11-25-18-10-9-16(32(29,30)24(5-2)6-3)14-17(18)23-21(25)31-13-8-12-26-19(27)15-22-20(26)28/h9-10,14H,4-8,11-13,15H2,1-3H3,(H,22,28) |
| InChIKey | HFDLWJQCUGVQMF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|