C18H22N4O3S3 — CID 4809908
2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4809908) has the molecular formula C18H22N4O3S3 and a molecular weight of 438.60 g/mol. Its IUPAC name is 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4809908 |
| Molecular Formula | C18H22N4O3S3 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)NCc2cccs2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H22N4O3S3/c1-2-3-8-22-16-7-6-14(28(19,24)25)10-15(16)21-18(22)27-12-17(23)20-11-13-5-4-9-26-13/h4-7,9-10H,2-3,8,11-12H2,1H3,(H,20,23)(H2,19,24,25) |
| InChIKey | HWCFNAPGLAHXJM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |