C19H19N2O3S- — CID 7000295
2-[2-[2-(4-ethylphenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate (PubChem CID 7000295) has the molecular formula C19H19N2O3S- and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[2-[2-(4-ethylphenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate.
| Compound Name | 2-[2-[2-(4-ethylphenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 7000295 |
| Molecular Formula | C19H19N2O3S- |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[2-[2-(4-ethylphenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate |
| SMILES | CCc1ccc(OCCSc2nc3ccccc3n2CC(=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-2-14-7-9-15(10-8-14)24-11-12-25-19-20-16-5-3-4-6-17(16)21(19)13-18(22)23/h3-10H,2,11-13H2,1H3,(H,22,23)/p-1 |
| InChIKey | YZIJTKFRBAFQDW-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|