C25H26N2O3S — CID 91046876
tert-butyl 2-[2-(2-naphthalen-2-yloxyethylsulfanyl)benzimidazol-1-yl]acetate (PubChem CID 91046876) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-naphthalen-2-yloxyethylsulfanyl)benzimidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-(2-naphthalen-2-yloxyethylsulfanyl)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 91046876 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | tert-butyl 2-[2-(2-naphthalen-2-yloxyethylsulfanyl)benzimidazol-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(SCCOc2ccc3ccccc3c2)nc2ccccc21 |
| InChI | InChI=1S/C25H26N2O3S/c1-25(2,3)30-23(28)17-27-22-11-7-6-10-21(22)26-24(27)31-15-14-29-20-13-12-18-8-4-5-9-19(18)16-20/h4-13,16H,14-15,17H2,1-3H3 |
| InChIKey | GFEGRBYVGISPHT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|