C28H35BrN4O4S2 — CID 160996724
tert-butyl 2-[2-(2-bromoethylsulfanyl)benzimidazol-1-yl]acetate;tert-butyl 2-(2-sulfanylidene-3H-benzimidazol-1-yl)acetate (PubChem CID 160996724) has the molecular formula C28H35BrN4O4S2 and a molecular weight of 635.65 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-bromoethylsulfanyl)benzimidazol-1-yl]acetate;tert-butyl 2-(2-sulfanylidene-3H-benzimidazol-1-yl)acetate.
| Compound Name | tert-butyl 2-[2-(2-bromoethylsulfanyl)benzimidazol-1-yl]acetate;tert-butyl 2-(2-sulfanylidene-3H-benzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 160996724 |
| Molecular Formula | C28H35BrN4O4S2 |
| Molecular Weight | 635.65 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | tert-butyl 2-[2-(2-bromoethylsulfanyl)benzimidazol-1-yl]acetate;tert-butyl 2-(2-sulfanylidene-3H-benzimidazol-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(=S)[nH]c2ccccc21.CC(C)(C)OC(=O)Cn1c(SCCBr)nc2ccccc21 |
| InChI | InChI=1S/C15H19BrN2O2S.C13H16N2O2S/c1-15(2,3)20-13(19)10-18-12-7-5-4-6-11(12)17-14(18)21-9-8-16;1-13(2,3)17-11(16)8-15-10-7-5-4-6-9(10)14-12(15)18/h4-7H,8-10H2,1-3H3;4-7H,8H2,1-3H3,(H,14,18) |
| InChIKey | TVIPLJZODPCURL-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.65 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|