C28H29N3O4S — CID 140526436
tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate (PubChem CID 140526436) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 140526436 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(SCCC(c2ccccc2)c2ccccc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C28H29N3O4S/c1-28(2,3)35-26(32)19-30-25-15-14-22(31(33)34)18-24(25)29-27(30)36-17-16-23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-15,18,23H,16-17,19H2,1-3H3 |
| InChIKey | MKKPQVWZFHDKLZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|