About tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate
tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate (PubChem CID 140526436) has the molecular formula C28H29N3O4S
and a molecular weight of 503.62 g/mol. Its IUPAC name is tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate |
| PubChem CID | 140526436 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(SCCC(c2ccccc2)c2ccccc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C28H29N3O4S/c1-28(2,3)35-26(32)19-30-25-15-14-22(31(33)34)18-24(25)29-27(30)36-17-16-23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-15,18,23H,16-17,19H2,1-3H3 |
| InChIKey | MKKPQVWZFHDKLZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate?
The IUPAC name of tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate (CID 140526436) is tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate.
What is the SMILES notation for tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate?
The canonical SMILES for tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate is CC(C)(C)OC(=O)Cn1c(SCCC(c2ccccc2)c2ccccc2)nc2cc([N+](=O)[O-])ccc21.
What is the InChIKey of tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate?
The InChIKey is MKKPQVWZFHDKLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29N3O4S/c1-28(2,3)35-26(32)19-30-25-15-14-22(31(33)34)18-24(25)29-27(30)36-17-16-23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-15,18,23H,16-17,19H2,1-3H3.
What are the key properties of tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate?
tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate has a molecular weight of 503.62 g/mol, XLogP of 6.60, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-(3,3-diphenylpropylsulfanyl)-5-nitrobenzimidazol-1-yl]acetate is sourced from PubChem (CID 140526436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).