C20H23N3O2 — CID 139827245
tert-butyl 2-(5-amino-2-benzylbenzimidazol-1-yl)acetate (PubChem CID 139827245) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl 2-(5-amino-2-benzylbenzimidazol-1-yl)acetate.
| Compound Name | tert-butyl 2-(5-amino-2-benzylbenzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 139827245 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | tert-butyl 2-(5-amino-2-benzylbenzimidazol-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(Cc2ccccc2)nc2cc(N)ccc21 |
| InChI | InChI=1S/C20H23N3O2/c1-20(2,3)25-19(24)13-23-17-10-9-15(21)12-16(17)22-18(23)11-14-7-5-4-6-8-14/h4-10,12H,11,13,21H2,1-3H3 |
| InChIKey | QYUWZLIGPKYZBS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|