C20H22N4O3 — CID 170748768
tert-butyl N-(7-amino-4-benzyl-3-oxoquinoxalin-2-yl)carbamate (PubChem CID 170748768) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is tert-butyl N-(7-amino-4-benzyl-3-oxoquinoxalin-2-yl)carbamate.
| Compound Name | tert-butyl N-(7-amino-4-benzyl-3-oxoquinoxalin-2-yl)carbamate |
|---|---|
| PubChem CID | 170748768 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | tert-butyl N-(7-amino-4-benzyl-3-oxoquinoxalin-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2cc(N)ccc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C20H22N4O3/c1-20(2,3)27-19(26)23-17-18(25)24(12-13-7-5-4-6-8-13)16-10-9-14(21)11-15(16)22-17/h4-11H,12,21H2,1-3H3,(H,22,23,26) |
| InChIKey | WYLCFILNSXVIJJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|