C20H24N2O5 — CID 71144248
ethyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypyridine-3-carboxylate (PubChem CID 71144248) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is ethyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypyridine-3-carboxylate.
| Compound Name | ethyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 71144248 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | ethyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=O)OC(C)(C)C)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N2O5/c1-5-25-18(23)15-11-16(26-13-14-9-7-6-8-10-14)17(21-12-15)22-19(24)27-20(2,3)4/h6-12H,5,13H2,1-4H3,(H,21,22,24) |
| InChIKey | LAHWIBVXJSHEPG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |