C15H22IN3O4 — CID 70296682
ethyl 5-iodo-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylate (PubChem CID 70296682) has the molecular formula C15H22IN3O4 and a molecular weight of 435.26 g/mol. Its IUPAC name is ethyl 5-iodo-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 5-iodo-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 70296682 |
| Molecular Formula | C15H22IN3O4 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | ethyl 5-iodo-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNC(=O)OC(C)(C)C)c(I)c1 |
| InChI | InChI=1S/C15H22IN3O4/c1-5-22-13(20)10-8-11(16)12(19-9-10)17-6-7-18-14(21)23-15(2,3)4/h8-9H,5-7H2,1-4H3,(H,17,19)(H,18,21) |
| InChIKey | DDEXCERRFKFUQY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|