C15H23N3O4 — CID 104695405
ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylate (PubChem CID 104695405) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 104695405 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23N3O4/c1-5-21-13(19)11-7-6-8-16-12(11)17-9-10-18-14(20)22-15(2,3)4/h6-8H,5,9-10H2,1-4H3,(H,16,17)(H,18,20) |
| InChIKey | HCBXISLFGYCJDB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|