C11H16N2O3S — CID 104695493
ethyl 2-(2-methylsulfinylethylamino)pyridine-3-carboxylate (PubChem CID 104695493) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is ethyl 2-(2-methylsulfinylethylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(2-methylsulfinylethylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 104695493 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 2-(2-methylsulfinylethylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCCS(C)=O |
| InChI | InChI=1S/C11H16N2O3S/c1-3-16-11(14)9-5-4-6-12-10(9)13-7-8-17(2)15/h4-6H,3,7-8H2,1-2H3,(H,12,13) |
| InChIKey | MWAGSRARHOLPBJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |