C15H23BrN4O3 — CID 155787018
tert-butyl N-[4-[(3-bromo-5-carbamoyl-2-pyridinyl)amino]butyl]carbamate (PubChem CID 155787018) has the molecular formula C15H23BrN4O3 and a molecular weight of 387.28 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-bromo-5-carbamoyl-2-pyridinyl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-bromo-5-carbamoyl-2-pyridinyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 155787018 |
| Molecular Formula | C15H23BrN4O3 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | tert-butyl N-[4-[(3-bromo-5-carbamoyl-2-pyridinyl)amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNc1ncc(C(N)=O)cc1Br |
| InChI | InChI=1S/C15H23BrN4O3/c1-15(2,3)23-14(22)19-7-5-4-6-18-13-11(16)8-10(9-20-13)12(17)21/h8-9H,4-7H2,1-3H3,(H2,17,21)(H,18,20)(H,19,22) |
| InChIKey | WVQMJOYIJCHTSJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|