C11H17BrN4O2 — CID 115714879
tert-butyl N-[2-[(5-bromopyrimidin-4-yl)amino]ethyl]carbamate (PubChem CID 115714879) has the molecular formula C11H17BrN4O2 and a molecular weight of 317.19 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-bromopyrimidin-4-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-bromopyrimidin-4-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 115714879 |
| Molecular Formula | C11H17BrN4O2 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | tert-butyl N-[2-[(5-bromopyrimidin-4-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ncncc1Br |
| InChI | InChI=1S/C11H17BrN4O2/c1-11(2,3)18-10(17)15-5-4-14-9-8(12)6-13-7-16-9/h6-7H,4-5H2,1-3H3,(H,15,17)(H,13,14,16) |
| InChIKey | QYNCUZYOSQNLGS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|