C21H30N6O4 — CID 70812241
benzyl N-[2-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidin-5-yl]amino]ethyl]carbamate (PubChem CID 70812241) has the molecular formula C21H30N6O4 and a molecular weight of 430.51 g/mol. Its IUPAC name is benzyl N-[2-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidin-5-yl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidin-5-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 70812241 |
| Molecular Formula | C21H30N6O4 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | benzyl N-[2-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyrimidin-5-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ncncc1NCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H30N6O4/c1-21(2,3)31-20(29)26-12-10-24-18-17(13-22-15-27-18)23-9-11-25-19(28)30-14-16-7-5-4-6-8-16/h4-8,13,15,23H,9-12,14H2,1-3H3,(H,25,28)(H,26,29)(H,22,24,27) |
| InChIKey | GHHBUAYMZMXCGQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|