C8H12BrN3O — CID 66340987
5-bromo-N-(2-ethoxyethyl)pyrimidin-4-amine (PubChem CID 66340987) has the molecular formula C8H12BrN3O and a molecular weight of 246.11 g/mol. Its IUPAC name is 5-bromo-N-(2-ethoxyethyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-N-(2-ethoxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66340987 |
| Molecular Formula | C8H12BrN3O |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 5-bromo-N-(2-ethoxyethyl)pyrimidin-4-amine |
| SMILES | CCOCCNc1ncncc1Br |
| InChI | InChI=1S/C8H12BrN3O/c1-2-13-4-3-11-8-7(9)5-10-6-12-8/h5-6H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | ZDLNRQNIOUSBRP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|