C11H19BrN4 — CID 66342316
N-(5-bromopyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 66342316) has the molecular formula C11H19BrN4 and a molecular weight of 287.20 g/mol. Its IUPAC name is N-(5-bromopyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(5-bromopyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 66342316 |
| Molecular Formula | C11H19BrN4 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-(5-bromopyrimidin-4-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ncncc1Br |
| InChI | InChI=1S/C11H19BrN4/c1-3-16(4-2)7-5-6-14-11-10(12)8-13-9-15-11/h8-9H,3-7H2,1-2H3,(H,13,14,15) |
| InChIKey | PTXKBQRQBWQALO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|