C16H26N4O3 — CID 131997583
tert-butyl N-[4-(2-amino-4-carbamoylanilino)butyl]carbamate (PubChem CID 131997583) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl N-[4-(2-amino-4-carbamoylanilino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-amino-4-carbamoylanilino)butyl]carbamate |
|---|---|
| PubChem CID | 131997583 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | tert-butyl N-[4-(2-amino-4-carbamoylanilino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNc1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C16H26N4O3/c1-16(2,3)23-15(22)20-9-5-4-8-19-13-7-6-11(14(18)21)10-12(13)17/h6-7,10,19H,4-5,8-9,17H2,1-3H3,(H2,18,21)(H,20,22) |
| InChIKey | XUVTWZIPJZCPAD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|