C17H28N4O3 — CID 164903401
tert-butyl N-[4-(2-amino-4-carbamoylanilino)pentyl]carbamate (PubChem CID 164903401) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is tert-butyl N-[4-(2-amino-4-carbamoylanilino)pentyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-amino-4-carbamoylanilino)pentyl]carbamate |
|---|---|
| PubChem CID | 164903401 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | tert-butyl N-[4-(2-amino-4-carbamoylanilino)pentyl]carbamate |
| SMILES | CC(CCCNC(=O)OC(C)(C)C)Nc1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C17H28N4O3/c1-11(6-5-9-20-16(23)24-17(2,3)4)21-14-8-7-12(15(19)22)10-13(14)18/h7-8,10-11,21H,5-6,9,18H2,1-4H3,(H2,19,22)(H,20,23) |
| InChIKey | DZOKRHLRTAMRIU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|