C18H30BrN3O2 — CID 175520983
tert-butyl N-[(5S)-5-(2-amino-4-bromo-6-methylanilino)hexyl]carbamate (PubChem CID 175520983) has the molecular formula C18H30BrN3O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-(2-amino-4-bromo-6-methylanilino)hexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-(2-amino-4-bromo-6-methylanilino)hexyl]carbamate |
|---|---|
| PubChem CID | 175520983 |
| Molecular Formula | C18H30BrN3O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | tert-butyl N-[(5S)-5-(2-amino-4-bromo-6-methylanilino)hexyl]carbamate |
| SMILES | Cc1cc(Br)cc(N)c1N[C@@H](C)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30BrN3O2/c1-12-10-14(19)11-15(20)16(12)22-13(2)8-6-7-9-21-17(23)24-18(3,4)5/h10-11,13,22H,6-9,20H2,1-5H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | VTQLMLOVZAFHLO-ZDUSSCGKSA-N |
| XLogP | 4.84 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|