C20H29BrN4O4 — CID 175521000
methyl 2-amino-6-bromo-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]benzimidazole-4-carboxylate (PubChem CID 175521000) has the molecular formula C20H29BrN4O4 and a molecular weight of 469.38 g/mol. Its IUPAC name is methyl 2-amino-6-bromo-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]benzimidazole-4-carboxylate.
| Compound Name | methyl 2-amino-6-bromo-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 175521000 |
| Molecular Formula | C20H29BrN4O4 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | methyl 2-amino-6-bromo-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc2nc(N)n(C(C)CCCCNC(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C20H29BrN4O4/c1-12(8-6-7-9-23-19(27)29-20(2,3)4)25-16-14(17(26)28-5)10-13(21)11-15(16)24-18(25)22/h10-12H,6-9H2,1-5H3,(H2,22,24)(H,23,27) |
| InChIKey | CZQIASANVOSXLN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|