C23H35N5O3 — CID 166454344
tert-butyl N-[5-[2-amino-7-(2-oxopiperidin-3-yl)benzimidazol-1-yl]hexyl]carbamate (PubChem CID 166454344) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is tert-butyl N-[5-[2-amino-7-(2-oxopiperidin-3-yl)benzimidazol-1-yl]hexyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-amino-7-(2-oxopiperidin-3-yl)benzimidazol-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 166454344 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | tert-butyl N-[5-[2-amino-7-(2-oxopiperidin-3-yl)benzimidazol-1-yl]hexyl]carbamate |
| SMILES | CC(CCCCNC(=O)OC(C)(C)C)n1c(N)nc2cccc(C3CCCNC3=O)c21 |
| InChI | InChI=1S/C23H35N5O3/c1-15(9-5-6-13-26-22(30)31-23(2,3)4)28-19-16(17-11-8-14-25-20(17)29)10-7-12-18(19)27-21(28)24/h7,10,12,15,17H,5-6,8-9,11,13-14H2,1-4H3,(H2,24,27)(H,25,29)(H,26,30) |
| InChIKey | KTQPZLJCMQMSNE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|