C37H46N4O5 — CID 155675350
tert-butyl N-[(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]carbamate (PubChem CID 155675350) has the molecular formula C37H46N4O5 and a molecular weight of 626.80 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 155675350 |
| Molecular Formula | C37H46N4O5 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | tert-butyl N-[(5S)-5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-(9H-fluoren-9-ylmethoxycarbonylamino)pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)c1nc(C23CC4CC(CC(C4)C2)C3)no1 |
| InChI | InChI=1S/C37H46N4O5/c1-36(2,3)45-34(42)38-15-9-8-14-31(32-40-33(41-46-32)37-19-23-16-24(20-37)18-25(17-23)21-37)39-35(43)44-22-30-28-12-6-4-10-26(28)27-11-5-7-13-29(27)30/h4-7,10-13,23-25,30-31H,8-9,14-22H2,1-3H3,(H,38,42)(H,39,43)/t23?,24?,25?,31-,37?/m0/s1 |
| InChIKey | BXCFYAZSJNMMAO-ZCJISUTISA-N |
| XLogP | 7.81 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|