C33H47N3O6 — CID 58772791
methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 58772791) has the molecular formula C33H47N3O6 and a molecular weight of 581.75 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 58772791 |
| Molecular Formula | C33H47N3O6 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC[C@@H](CC(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H47N3O6/c1-22(2)19-23(20-35-29(30(37)40-6)17-11-12-18-34-31(38)42-33(3,4)5)36-32(39)41-21-28-26-15-9-7-13-24(26)25-14-8-10-16-27(25)28/h7-10,13-16,22-23,28-29,35H,11-12,17-21H2,1-6H3,(H,34,38)(H,36,39)/t23-,29+/m1/s1 |
| InChIKey | TXRBBNJCYSCHBF-BTYSJIOQSA-N |
| XLogP | 5.77 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|