C32H42N4O7 — CID 166454449
methyl 3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]-2-[[3-[(2-methylpropan-2-yl)oxycarbonyl]benzoyl]amino]benzimidazole-4-carboxylate (PubChem CID 166454449) has the molecular formula C32H42N4O7 and a molecular weight of 594.71 g/mol. Its IUPAC name is methyl 3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]-2-[[3-[(2-methylpropan-2-yl)oxycarbonyl]benzoyl]amino]benzimidazole-4-carboxylate.
| Compound Name | methyl 3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]-2-[[3-[(2-methylpropan-2-yl)oxycarbonyl]benzoyl]amino]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 166454449 |
| Molecular Formula | C32H42N4O7 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | methyl 3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]-2-[[3-[(2-methylpropan-2-yl)oxycarbonyl]benzoyl]amino]benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2nc(NC(=O)c3cccc(C(=O)OC(C)(C)C)c3)n(C(C)CCCCNC(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C32H42N4O7/c1-20(13-9-10-18-33-30(40)43-32(5,6)7)36-25-23(28(39)41-8)16-12-17-24(25)34-29(36)35-26(37)21-14-11-15-22(19-21)27(38)42-31(2,3)4/h11-12,14-17,19-20H,9-10,13,18H2,1-8H3,(H,33,40)(H,34,35,37) |
| InChIKey | BLEUPLGTEJPOMA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|