C19H28N4O4 — CID 166454564
methyl 2-amino-3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]benzimidazole-5-carboxylate (PubChem CID 166454564) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is methyl 2-amino-3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]benzimidazole-5-carboxylate.
| Compound Name | methyl 2-amino-3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 166454564 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | methyl 2-amino-3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(N)n(CCCCCNC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H28N4O4/c1-19(2,3)27-18(25)21-10-6-5-7-11-23-15-12-13(16(24)26-4)8-9-14(15)22-17(23)20/h8-9,12H,5-7,10-11H2,1-4H3,(H2,20,22)(H,21,25) |
| InChIKey | GOKMRXDGFQCCSP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|