C18H27N3O5 — CID 146312405
methyl 3-amino-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylcarbamoyl]benzoate (PubChem CID 146312405) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is methyl 3-amino-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylcarbamoyl]benzoate.
| Compound Name | methyl 3-amino-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 146312405 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | methyl 3-amino-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cc(N)cc(C(=O)NCCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H27N3O5/c1-18(2,3)26-17(24)21-8-6-5-7-20-15(22)12-9-13(16(23)25-4)11-14(19)10-12/h9-11H,5-8,19H2,1-4H3,(H,20,22)(H,21,24) |
| InChIKey | TVCSKQUQOUBUOD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|