C23H34N2O7 — CID 146223428
dimethyl 5-[6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexylcarbamoyl]benzene-1,3-dicarboxylate (PubChem CID 146223428) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is dimethyl 5-[6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexylcarbamoyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexylcarbamoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146223428 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | dimethyl 5-[6-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexylcarbamoyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)NCCCCCCN(C)C(=O)OC(C)(C)C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H34N2O7/c1-23(2,3)32-22(29)25(4)12-10-8-7-9-11-24-19(26)16-13-17(20(27)30-5)15-18(14-16)21(28)31-6/h13-15H,7-12H2,1-6H3,(H,24,26) |
| InChIKey | VAEYJZZPBQIQTR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|