C14H28N4O2S — CID 87855894
tert-butyl N-[4-[[(E)-dimethylaminomethylidenecarbamothioyl]amino]butyl]-N-methylcarbamate (PubChem CID 87855894) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is tert-butyl N-[4-[[(E)-dimethylaminomethylidenecarbamothioyl]amino]butyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[[(E)-dimethylaminomethylidenecarbamothioyl]amino]butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 87855894 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl N-[4-[[(E)-dimethylaminomethylidenecarbamothioyl]amino]butyl]-N-methylcarbamate |
| SMILES | CN(C)/C=N/C(=S)NCCCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N4O2S/c1-14(2,3)20-13(19)18(6)10-8-7-9-15-12(21)16-11-17(4)5/h11H,7-10H2,1-6H3,(H,15,21)/b16-11+ |
| InChIKey | ALFAEOYQHCTQTP-LFIBNONCSA-N |
| XLogP | 2.10 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|