C16H33N3O2 — CID 170112382
tert-butyl N-[4-[3-[ethenyl(methyl)amino]propylamino]butyl]-N-methylcarbamate (PubChem CID 170112382) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[ethenyl(methyl)amino]propylamino]butyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[3-[ethenyl(methyl)amino]propylamino]butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170112382 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | tert-butyl N-[4-[3-[ethenyl(methyl)amino]propylamino]butyl]-N-methylcarbamate |
| SMILES | C=CN(C)CCCNCCCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H33N3O2/c1-7-18(5)13-10-12-17-11-8-9-14-19(6)15(20)21-16(2,3)4/h7,17H,1,8-14H2,2-6H3 |
| InChIKey | NGCIZYPDOYBHDO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|