C27H53N3O6 — CID 11800012
tert-butyl N,N-bis[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate (PubChem CID 11800012) has the molecular formula C27H53N3O6 and a molecular weight of 515.74 g/mol. Its IUPAC name is tert-butyl N,N-bis[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate.
| Compound Name | tert-butyl N,N-bis[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 11800012 |
| Molecular Formula | C27H53N3O6 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.39 |
| IUPAC Name | tert-butyl N,N-bis[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCN(CCCCCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H53N3O6/c1-25(2,3)34-22(31)28-18-14-10-12-16-20-30(24(33)36-27(7,8)9)21-17-13-11-15-19-29-23(32)35-26(4,5)6/h10-21H2,1-9H3,(H,28,31)(H,29,32) |
| InChIKey | UYVFRRXWBGBPPB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|