C20H39N3O8S — CID 10648462
methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]butylsulfamoyl]acetate (PubChem CID 10648462) has the molecular formula C20H39N3O8S and a molecular weight of 481.61 g/mol. Its IUPAC name is methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]butylsulfamoyl]acetate.
| Compound Name | methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]butylsulfamoyl]acetate |
|---|---|
| PubChem CID | 10648462 |
| Molecular Formula | C20H39N3O8S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]butylsulfamoyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)NCCCCN(CCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39N3O8S/c1-19(2,3)30-17(25)21-11-10-14-23(18(26)31-20(4,5)6)13-9-8-12-22-32(27,28)15-16(24)29-7/h22H,8-15H2,1-7H3,(H,21,25) |
| InChIKey | NVYAOCNJXPMNGX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|