C22H43N3O6 — CID 87552079
tert-butyl 2-amino-5-[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoate (PubChem CID 87552079) has the molecular formula C22H43N3O6 and a molecular weight of 445.60 g/mol. Its IUPAC name is tert-butyl 2-amino-5-[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoate.
| Compound Name | tert-butyl 2-amino-5-[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoate |
|---|---|
| PubChem CID | 87552079 |
| Molecular Formula | C22H43N3O6 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | tert-butyl 2-amino-5-[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCC(N)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H43N3O6/c1-20(2,3)29-17(26)16(23)12-10-14-25(19(28)31-22(7,8)9)15-11-13-24-18(27)30-21(4,5)6/h16H,10-15,23H2,1-9H3,(H,24,27) |
| InChIKey | IWWQDFXPQAMPTB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|