C14H28N4O6 — CID 59993765
tert-butyl N-[3-[(2-aminooxyacetyl)amino]propyl]-N-[2-(methoxycarbonylamino)ethyl]carbamate (PubChem CID 59993765) has the molecular formula C14H28N4O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-aminooxyacetyl)amino]propyl]-N-[2-(methoxycarbonylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-aminooxyacetyl)amino]propyl]-N-[2-(methoxycarbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 59993765 |
| Molecular Formula | C14H28N4O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | tert-butyl N-[3-[(2-aminooxyacetyl)amino]propyl]-N-[2-(methoxycarbonylamino)ethyl]carbamate |
| SMILES | COC(=O)NCCN(CCCNC(=O)CON)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N4O6/c1-14(2,3)24-13(21)18(9-7-17-12(20)22-4)8-5-6-16-11(19)10-23-15/h5-10,15H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | QHMCJLDMYHUWPU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|