C12H23N3O6 — CID 91748741
methyl N,N-bis[3-(methoxycarbonylamino)propyl]carbamate (PubChem CID 91748741) has the molecular formula C12H23N3O6 and a molecular weight of 305.33 g/mol. Its IUPAC name is methyl N,N-bis[3-(methoxycarbonylamino)propyl]carbamate.
| Compound Name | methyl N,N-bis[3-(methoxycarbonylamino)propyl]carbamate |
|---|---|
| PubChem CID | 91748741 |
| Molecular Formula | C12H23N3O6 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | methyl N,N-bis[3-(methoxycarbonylamino)propyl]carbamate |
| SMILES | COC(=O)NCCCN(CCCNC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H23N3O6/c1-19-10(16)13-6-4-8-15(12(18)21-3)9-5-7-14-11(17)20-2/h4-9H2,1-3H3,(H,13,16)(H,14,17) |
| InChIKey | XUDCEKFZZBVYFS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|