C15H35N3O4 — CID 143730822
methyl N-[3-[3-acetamidopropyl(acetyl)amino]propyl]carbamate;molecular hydrogen;propane (PubChem CID 143730822) has the molecular formula C15H35N3O4 and a molecular weight of 321.46 g/mol. Its IUPAC name is methyl N-[3-[3-acetamidopropyl(acetyl)amino]propyl]carbamate;molecular hydrogen;propane.
| Compound Name | methyl N-[3-[3-acetamidopropyl(acetyl)amino]propyl]carbamate;molecular hydrogen;propane |
|---|---|
| PubChem CID | 143730822 |
| Molecular Formula | C15H35N3O4 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | methyl N-[3-[3-acetamidopropyl(acetyl)amino]propyl]carbamate;molecular hydrogen;propane |
| SMILES | CCC.COC(=O)NCCCN(CCCNC(C)=O)C(C)=O.[H][H].[H][H] |
| InChI | InChI=1S/C12H23N3O4.C3H8.2H2/c1-10(16)13-6-4-8-15(11(2)17)9-5-7-14-12(18)19-3;1-3-2;;/h4-9H2,1-3H3,(H,13,16)(H,14,18);3H2,1-2H3;2*1H |
| InChIKey | XJPWJYOUWAAQAL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|