About N-butylacetamide;molecular hydrogen
N-butylacetamide;molecular hydrogen (PubChem CID 142252069) has the molecular formula C6H15NO
and a molecular weight of 117.19 g/mol. Its IUPAC name is N-butylacetamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-butylacetamide;molecular hydrogen |
| PubChem CID | 142252069 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | N-butylacetamide;molecular hydrogen |
| SMILES | CCCCNC(C)=O.[H][H] |
| InChI | InChI=1S/C6H13NO.H2/c1-3-4-5-7-6(2)8;/h3-5H2,1-2H3,(H,7,8);1H |
| InChIKey | CDRFBHIBWCEUDP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylacetamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylacetamide;molecular hydrogen?
The IUPAC name of N-butylacetamide;molecular hydrogen (CID 142252069) is N-butylacetamide;molecular hydrogen.
What is the SMILES notation for N-butylacetamide;molecular hydrogen?
The canonical SMILES for N-butylacetamide;molecular hydrogen is CCCCNC(C)=O.[H][H].
What is the InChIKey of N-butylacetamide;molecular hydrogen?
The InChIKey is CDRFBHIBWCEUDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.H2/c1-3-4-5-7-6(2)8;/h3-5H2,1-2H3,(H,7,8);1H.
What are the key properties of N-butylacetamide;molecular hydrogen?
N-butylacetamide;molecular hydrogen has a molecular weight of 117.19 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylacetamide;molecular hydrogen is sourced from PubChem (CID 142252069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).