About N-pentadecylacetamide
N-pentadecylacetamide (PubChem CID 12009452) has the molecular formula C17H35NO
and a molecular weight of 269.47 g/mol. Its IUPAC name is N-pentadecylacetamide.
Molecular Properties
| Compound Name | N-pentadecylacetamide |
| PubChem CID | 12009452 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | N-pentadecylacetamide |
| SMILES | CCCCCCCCCCCCCCCNC(C)=O |
| InChI | InChI=1S/C17H35NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-17(2)19/h3-16H2,1-2H3,(H,18,19) |
| InChIKey | JHHXEQAVFNLSQT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-pentadecylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentadecylacetamide?
The IUPAC name of N-pentadecylacetamide (CID 12009452) is N-pentadecylacetamide.
What is the SMILES notation for N-pentadecylacetamide?
The canonical SMILES for N-pentadecylacetamide is CCCCCCCCCCCCCCCNC(C)=O.
What is the InChIKey of N-pentadecylacetamide?
The InChIKey is JHHXEQAVFNLSQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-17(2)19/h3-16H2,1-2H3,(H,18,19).
What are the key properties of N-pentadecylacetamide?
N-pentadecylacetamide has a molecular weight of 269.47 g/mol, XLogP of 5.21, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentadecylacetamide is sourced from PubChem (CID 12009452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).