About N-nonadecylacetamide
N-nonadecylacetamide (PubChem CID 54574805) has the molecular formula C21H43NO
and a molecular weight of 325.58 g/mol. Its IUPAC name is N-nonadecylacetamide.
Molecular Properties
| Compound Name | N-nonadecylacetamide |
| PubChem CID | 54574805 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | N-nonadecylacetamide |
| SMILES | CCCCCCCCCCCCCCCCCCCNC(C)=O |
| InChI | InChI=1S/C21H43NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-21(2)23/h3-20H2,1-2H3,(H,22,23) |
| InChIKey | ZZVANUSNDCQEMC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-nonadecylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nonadecylacetamide?
The IUPAC name of N-nonadecylacetamide (CID 54574805) is N-nonadecylacetamide.
What is the SMILES notation for N-nonadecylacetamide?
The canonical SMILES for N-nonadecylacetamide is CCCCCCCCCCCCCCCCCCCNC(C)=O.
What is the InChIKey of N-nonadecylacetamide?
The InChIKey is ZZVANUSNDCQEMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-21(2)23/h3-20H2,1-2H3,(H,22,23).
What are the key properties of N-nonadecylacetamide?
N-nonadecylacetamide has a molecular weight of 325.58 g/mol, XLogP of 6.77, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-nonadecylacetamide is sourced from PubChem (CID 54574805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).