About N-butylacetamide;propanoic acid
N-butylacetamide;propanoic acid (PubChem CID 87146552) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is N-butylacetamide;propanoic acid.
Molecular Properties
| Compound Name | N-butylacetamide;propanoic acid |
| PubChem CID | 87146552 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-butylacetamide;propanoic acid |
| SMILES | CCC(=O)O.CCCCNC(C)=O |
| InChI | InChI=1S/C6H13NO.C3H6O2/c1-3-4-5-7-6(2)8;1-2-3(4)5/h3-5H2,1-2H3,(H,7,8);2H2,1H3,(H,4,5) |
| InChIKey | DXRQJCFSYVGHJX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylacetamide;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylacetamide;propanoic acid?
The IUPAC name of N-butylacetamide;propanoic acid (CID 87146552) is N-butylacetamide;propanoic acid.
What is the SMILES notation for N-butylacetamide;propanoic acid?
The canonical SMILES for N-butylacetamide;propanoic acid is CCC(=O)O.CCCCNC(C)=O.
What is the InChIKey of N-butylacetamide;propanoic acid?
The InChIKey is DXRQJCFSYVGHJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C3H6O2/c1-3-4-5-7-6(2)8;1-2-3(4)5/h3-5H2,1-2H3,(H,7,8);2H2,1H3,(H,4,5).
What are the key properties of N-butylacetamide;propanoic acid?
N-butylacetamide;propanoic acid has a molecular weight of 189.25 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylacetamide;propanoic acid is sourced from PubChem (CID 87146552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).