About butylcarbamic acid;zinc
butylcarbamic acid;zinc (PubChem CID 141049802) has the molecular formula C10H22N2O4Zn
and a molecular weight of 299.69 g/mol. Its IUPAC name is butylcarbamic acid;zinc.
Molecular Properties
| Compound Name | butylcarbamic acid;zinc |
| PubChem CID | 141049802 |
| Molecular Formula | C10H22N2O4Zn |
| Molecular Weight | 299.69 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | butylcarbamic acid;zinc |
| SMILES | CCCCNC(=O)O.CCCCNC(=O)O.[Zn] |
| InChI | InChI=1S/2C5H11NO2.Zn/c2*1-2-3-4-6-5(7)8;/h2*6H,2-4H2,1H3,(H,7,8); |
| InChIKey | OGDQNQRUHDNONR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butylcarbamic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylcarbamic acid;zinc?
The IUPAC name of butylcarbamic acid;zinc (CID 141049802) is butylcarbamic acid;zinc.
What is the SMILES notation for butylcarbamic acid;zinc?
The canonical SMILES for butylcarbamic acid;zinc is CCCCNC(=O)O.CCCCNC(=O)O.[Zn].
What is the InChIKey of butylcarbamic acid;zinc?
The InChIKey is OGDQNQRUHDNONR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11NO2.Zn/c2*1-2-3-4-6-5(7)8;/h2*6H,2-4H2,1H3,(H,7,8);.
What are the key properties of butylcarbamic acid;zinc?
butylcarbamic acid;zinc has a molecular weight of 299.69 g/mol, XLogP of 2.11, 6 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butylcarbamic acid;zinc is sourced from PubChem (CID 141049802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).