C16H15F20NO3 — CID 157421110
butylcarbamic acid;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluoroundecan-1-ol (PubChem CID 157421110) has the molecular formula C16H15F20NO3 and a molecular weight of 649.26 g/mol. Its IUPAC name is butylcarbamic acid;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluoroundecan-1-ol.
| Compound Name | butylcarbamic acid;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluoroundecan-1-ol |
|---|---|
| PubChem CID | 157421110 |
| Molecular Formula | C16H15F20NO3 |
| Molecular Weight | 649.26 g/mol |
| Exact Mass | 649.07 |
| IUPAC Name | butylcarbamic acid;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluoroundecan-1-ol |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)(F)F.CCCCNC(=O)O |
| InChI | InChI=1S/C11H4F20O.C5H11NO2/c1-2(12,13)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32;1-2-3-4-6-5(7)8/h32H,1H3;6H,2-4H2,1H3,(H,7,8) |
| InChIKey | BPKLJRCXLUSFNP-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.26 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|