C8H11F6NO — CID 2748453
N-butyl-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 2748453) has the molecular formula C8H11F6NO and a molecular weight of 251.17 g/mol. Its IUPAC name is N-butyl-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-butyl-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 2748453 |
| Molecular Formula | C8H11F6NO |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-butyl-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CCCCNC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H11F6NO/c1-2-3-4-15-6(16)5(7(9,10)11)8(12,13)14/h5H,2-4H2,1H3,(H,15,16) |
| InChIKey | NZYLHAAYRSPYMJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|