C10H15F6NO2 — CID 107844083
3,3,3-trifluoro-N-(6-hydroxyhexyl)-2-(trifluoromethyl)propanamide (PubChem CID 107844083) has the molecular formula C10H15F6NO2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(6-hydroxyhexyl)-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(6-hydroxyhexyl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 107844083 |
| Molecular Formula | C10H15F6NO2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3,3,3-trifluoro-N-(6-hydroxyhexyl)-2-(trifluoromethyl)propanamide |
| SMILES | O=C(NCCCCCCO)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H15F6NO2/c11-9(12,13)7(10(14,15)16)8(19)17-5-3-1-2-4-6-18/h7,18H,1-6H2,(H,17,19) |
| InChIKey | UUXBPHPLGJLJCA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|