C18H40N2O2Si2 — CID 10667035
(2R,3S)-N,N'-dibutyl-2,3-bis(trimethylsilyl)butanediamide (PubChem CID 10667035) has the molecular formula C18H40N2O2Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is (2R,3S)-N,N'-dibutyl-2,3-bis(trimethylsilyl)butanediamide.
| Compound Name | (2R,3S)-N,N'-dibutyl-2,3-bis(trimethylsilyl)butanediamide |
|---|---|
| PubChem CID | 10667035 |
| Molecular Formula | C18H40N2O2Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | (2R,3S)-N,N'-dibutyl-2,3-bis(trimethylsilyl)butanediamide |
| SMILES | CCCCNC(=O)[C@H]([C@H](C(=O)NCCCC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H40N2O2Si2/c1-9-11-13-19-17(21)15(23(3,4)5)16(24(6,7)8)18(22)20-14-12-10-2/h15-16H,9-14H2,1-8H3,(H,19,21)(H,20,22)/t15-,16+ |
| InChIKey | HWSKOSVDYRPQHG-IYBDPMFKSA-N |
| XLogP | 4.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|