About butylcarbamoylazanium
butylcarbamoylazanium (PubChem CID 143909883) has the molecular formula C5H13N2O+
and a molecular weight of 117.17 g/mol. Its IUPAC name is butylcarbamoylazanium.
Molecular Properties
| Compound Name | butylcarbamoylazanium |
| PubChem CID | 143909883 |
| Molecular Formula | C5H13N2O+ |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | butylcarbamoylazanium |
| SMILES | CCCCNC([NH3+])=O |
| InChI | InChI=1S/C5H12N2O/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H3,6,7,8)/p+1 |
| InChIKey | CNWSQCLBDWYLAN-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butylcarbamoylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylcarbamoylazanium?
The IUPAC name of butylcarbamoylazanium (CID 143909883) is butylcarbamoylazanium.
What is the SMILES notation for butylcarbamoylazanium?
The canonical SMILES for butylcarbamoylazanium is CCCCNC([NH3+])=O.
What is the InChIKey of butylcarbamoylazanium?
The InChIKey is CNWSQCLBDWYLAN-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H12N2O/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H3,6,7,8)/p+1.
What are the key properties of butylcarbamoylazanium?
butylcarbamoylazanium has a molecular weight of 117.17 g/mol, XLogP of -0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butylcarbamoylazanium is sourced from PubChem (CID 143909883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).