About 1-butyl-3-methylurea;hydrochloride
1-butyl-3-methylurea;hydrochloride (PubChem CID 20501295) has the molecular formula C6H15ClN2O
and a molecular weight of 166.65 g/mol. Its IUPAC name is 1-butyl-3-methylurea;hydrochloride.
Molecular Properties
| Compound Name | 1-butyl-3-methylurea;hydrochloride |
| PubChem CID | 20501295 |
| Molecular Formula | C6H15ClN2O |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1-butyl-3-methylurea;hydrochloride |
| SMILES | CCCCNC(=O)NC.Cl |
| InChI | InChI=1S/C6H14N2O.ClH/c1-3-4-5-8-6(9)7-2;/h3-5H2,1-2H3,(H2,7,8,9);1H |
| InChIKey | DSEIYVIIRLSQTE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylurea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylurea;hydrochloride?
The IUPAC name of 1-butyl-3-methylurea;hydrochloride (CID 20501295) is 1-butyl-3-methylurea;hydrochloride.
What is the SMILES notation for 1-butyl-3-methylurea;hydrochloride?
The canonical SMILES for 1-butyl-3-methylurea;hydrochloride is CCCCNC(=O)NC.Cl.
What is the InChIKey of 1-butyl-3-methylurea;hydrochloride?
The InChIKey is DSEIYVIIRLSQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.ClH/c1-3-4-5-8-6(9)7-2;/h3-5H2,1-2H3,(H2,7,8,9);1H.
What are the key properties of 1-butyl-3-methylurea;hydrochloride?
1-butyl-3-methylurea;hydrochloride has a molecular weight of 166.65 g/mol, XLogP of 1.14, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylurea;hydrochloride is sourced from PubChem (CID 20501295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).