About CID 59151849
CID 59151849 (PubChem CID 59151849) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol.
Molecular Properties
| Compound Name | CID 59151849 |
| PubChem CID | 59151849 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | — |
| SMILES | [CH]CCCNC(=O)NC |
| InChI | InChI=1S/C6H12N2O/c1-3-4-5-8-6(9)7-2/h1H,3-5H2,2H3,(H2,7,8,9) |
| InChIKey | FUBKXDJOSSJYBZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 59151849 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59151849?
The IUPAC name of CID 59151849 (CID 59151849) is not available.
What is the SMILES notation for CID 59151849?
The canonical SMILES for CID 59151849 is [CH]CCCNC(=O)NC.
What is the InChIKey of CID 59151849?
The InChIKey is FUBKXDJOSSJYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-3-4-5-8-6(9)7-2/h1H,3-5H2,2H3,(H2,7,8,9).
What are the key properties of CID 59151849?
CID 59151849 has a molecular weight of 128.17 g/mol, XLogP of 0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59151849 is sourced from PubChem (CID 59151849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).