About lithium;6-(methylcarbamoylamino)hexanoate;phosphanide
lithium;6-(methylcarbamoylamino)hexanoate;phosphanide (PubChem CID 59895303) has the molecular formula C8H17LiN2O3P-
and a molecular weight of 227.15 g/mol. Its IUPAC name is lithium;6-(methylcarbamoylamino)hexanoate;phosphanide.
Molecular Properties
| Compound Name | lithium;6-(methylcarbamoylamino)hexanoate;phosphanide |
| PubChem CID | 59895303 |
| Molecular Formula | C8H17LiN2O3P- |
| Molecular Weight | 227.15 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | lithium;6-(methylcarbamoylamino)hexanoate;phosphanide |
| SMILES | CNC(=O)NCCCCCC(=O)[O-].[Li+].[PH2-] |
| InChI | InChI=1S/C8H16N2O3.Li.H2P/c1-9-8(13)10-6-4-2-3-5-7(11)12;;/h2-6H2,1H3,(H,11,12)(H2,9,10,13);;1H2/q;+1;-1/p-1 |
| InChIKey | YUOCWCMLZKHNFB-UHFFFAOYSA-M |
| XLogP | -3.44 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.15 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;6-(methylcarbamoylamino)hexanoate;phosphanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;6-(methylcarbamoylamino)hexanoate;phosphanide?
The IUPAC name of lithium;6-(methylcarbamoylamino)hexanoate;phosphanide (CID 59895303) is lithium;6-(methylcarbamoylamino)hexanoate;phosphanide.
What is the SMILES notation for lithium;6-(methylcarbamoylamino)hexanoate;phosphanide?
The canonical SMILES for lithium;6-(methylcarbamoylamino)hexanoate;phosphanide is CNC(=O)NCCCCCC(=O)[O-].[Li+].[PH2-].
What is the InChIKey of lithium;6-(methylcarbamoylamino)hexanoate;phosphanide?
The InChIKey is YUOCWCMLZKHNFB-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N2O3.Li.H2P/c1-9-8(13)10-6-4-2-3-5-7(11)12;;/h2-6H2,1H3,(H,11,12)(H2,9,10,13);;1H2/q;+1;-1/p-1.
What are the key properties of lithium;6-(methylcarbamoylamino)hexanoate;phosphanide?
lithium;6-(methylcarbamoylamino)hexanoate;phosphanide has a molecular weight of 227.15 g/mol, XLogP of -3.44, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;6-(methylcarbamoylamino)hexanoate;phosphanide is sourced from PubChem (CID 59895303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).