About lithium 4-acetamidobutanoate
lithium 4-acetamidobutanoate (PubChem CID 23665991) has the molecular formula C6H10LiNO3
and a molecular weight of 151.09 g/mol. Its IUPAC name is lithium 4-acetamidobutanoate.
Molecular Properties
| Compound Name | lithium 4-acetamidobutanoate |
| PubChem CID | 23665991 |
| Molecular Formula | C6H10LiNO3 |
| Molecular Weight | 151.09 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | lithium 4-acetamidobutanoate |
| SMILES | CC(=O)NCCCC(=O)[O-].[Li+] |
| InChI | InChI=1S/C6H11NO3.Li/c1-5(8)7-4-2-3-6(9)10;/h2-4H2,1H3,(H,7,8)(H,9,10);/q;+1/p-1 |
| InChIKey | FTMPCGKUYIKUNF-UHFFFAOYSA-M |
| XLogP | -4.34 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.09 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium 4-acetamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 4-acetamidobutanoate?
The IUPAC name of lithium 4-acetamidobutanoate (CID 23665991) is lithium 4-acetamidobutanoate.
What is the SMILES notation for lithium 4-acetamidobutanoate?
The canonical SMILES for lithium 4-acetamidobutanoate is CC(=O)NCCCC(=O)[O-].[Li+].
What is the InChIKey of lithium 4-acetamidobutanoate?
The InChIKey is FTMPCGKUYIKUNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11NO3.Li/c1-5(8)7-4-2-3-6(9)10;/h2-4H2,1H3,(H,7,8)(H,9,10);/q;+1/p-1.
What are the key properties of lithium 4-acetamidobutanoate?
lithium 4-acetamidobutanoate has a molecular weight of 151.09 g/mol, XLogP of -4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 4-acetamidobutanoate is sourced from PubChem (CID 23665991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).